[go: nahoru, domu]

blob: 8f175bb63edbcc587f884b990c6e2d7f48abbb35 [file] [log] [blame]
/*
* Copyright 2019 The Android Open Source Project
*
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
*
* http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
* See the License for the specific language governing permissions and
* limitations under the License.
*/
package android.security.identity;
import android.annotation.NonNull;
import android.annotation.Nullable;
import java.security.InvalidKeyException;
import java.security.KeyPair;
import java.security.PublicKey;
import java.security.cert.X509Certificate;
import java.time.Instant;
import java.util.Collection;
import java.util.Map;
/**
* Class used to read data from a previously provisioned credential.
*
* Use {@link IdentityCredentialStore#getCredentialByName(String, int)} to get a
* {@link IdentityCredential} instance.
*/
public abstract class IdentityCredential {
/**
* @hide
*/
protected IdentityCredential() {}
/**
* Create an ephemeral key pair to use to establish a secure channel with a reader.
*
* <p>Applications should use this key-pair for the communications channel with the reader
* using a protocol / cipher-suite appropriate for the application. One example of such a
* protocol is the one used for Mobile Driving Licenses, see ISO 18013-5 section 9.2.1 "Session
* encryption".
*
* @return ephemeral key pair to use to establish a secure channel with a reader.
*/
public @NonNull abstract KeyPair createEphemeralKeyPair();
/**
* Set the ephemeral public key provided by the reader. If called, this must be called before
* {@link #getEntries(byte[], Map, byte[], byte[])} is called.
*
* @param readerEphemeralPublicKey The ephemeral public key provided by the reader to
* establish a secure session.
* @throws InvalidKeyException if the given key is invalid.
*/
public abstract void setReaderEphemeralPublicKey(@NonNull PublicKey readerEphemeralPublicKey)
throws InvalidKeyException;
/**
* Encrypt a message for transmission to the reader.
*
* <p>Do not use. In this version of the API, this method produces an incorrect
* result. Instead, applications should implement message encryption/decryption themselves as
* detailed in the {@link #createEphemeralKeyPair()} method. In a future API-level, this
* method will be deprecated.
*
* @param messagePlaintext unencrypted message to encrypt.
* @return encrypted message.
*/
public @NonNull abstract byte[] encryptMessageToReader(@NonNull byte[] messagePlaintext);
/**
* Decrypt a message received from the reader.
*
* <p>Do not use. In this version of the API, this method produces an incorrect
* result. Instead, applications should implement message encryption/decryption themselves as
* detailed in the {@link #createEphemeralKeyPair()} method. In a future API-level, this
* method will be deprecated.
*
* @param messageCiphertext encrypted message to decrypt.
* @return decrypted message.
* @throws MessageDecryptionException if the ciphertext couldn't be decrypted.
*/
public @NonNull abstract byte[] decryptMessageFromReader(@NonNull byte[] messageCiphertext)
throws MessageDecryptionException;
/**
* Gets the X.509 certificate chain for the CredentialKey which identifies this
* credential to the issuing authority. This is the same certificate chain that
* was returned by {@link WritableIdentityCredential#getCredentialKeyCertificateChain(byte[])}
* when the credential was first created and its Android Keystore extension will
* contain the <code>challenge</code> data set at that time. See the documentation
* for that method for important information about this certificate chain.
*
* @return the certificate chain for this credential's CredentialKey.
*/
public @NonNull abstract Collection<X509Certificate> getCredentialKeyCertificateChain();
/**
* Sets whether to allow using an authentication key which use count has been exceeded if no
* other key is available. This must be called prior to calling
* {@link #getEntries(byte[], Map, byte[], byte[])}.
*
* By default this is set to true.
*
* @param allowUsingExhaustedKeys whether to allow using an authentication key which use count
* has been exceeded if no other key is available.
*/
public abstract void setAllowUsingExhaustedKeys(boolean allowUsingExhaustedKeys);
/**
* Sets whether to allow using an authentication key which has been expired if no
* other key is available. This must be called prior to calling
* {@link #getEntries(byte[], Map, byte[], byte[])}.
*
* <p>By default this is set to false.
*
* <p>This is only implemented in feature version 202101 or later. If not implemented, the call
* fails with {@link UnsupportedOperationException}. See
* {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known
* feature versions.
*
* @param allowUsingExpiredKeys whether to allow using an authentication key which use count
* has been exceeded if no other key is available.
*/
public void setAllowUsingExpiredKeys(boolean allowUsingExpiredKeys) {
throw new UnsupportedOperationException();
}
/**
* Called by android.hardware.biometrics.CryptoObject#getOpId() to get an
* operation handle.
*
* @hide
*/
public abstract long getCredstoreOperationHandle();
/**
* Retrieve data entries and associated data from this {@code IdentityCredential}.
*
* <p>If an access control check fails for one of the requested entries or if the entry
* doesn't exist, the entry is simply not returned. The application can detect this
* by using the {@link ResultData#getStatus(String, String)} method on each of the requested
* entries.
*
* <p>It is the responsibility of the calling application to know if authentication is needed
* and use e.g. {@link android.hardware.biometrics.BiometricPrompt} to make the user
* authenticate using a {@link android.hardware.biometrics.BiometricPrompt.CryptoObject} which
* references this object. If needed, this must be done before calling
* {@link #getEntries(byte[], Map, byte[], byte[])}.
*
* <p>It is permissible to call this method multiple times using the same instance but if this
* is done, the {@code sessionTranscript} parameter must be identical for each call. If this is
* not the case, the {@link SessionTranscriptMismatchException} exception is thrown.
*
* <p>If not {@code null} the {@code requestMessage} parameter must contain data for the request
* from the verifier. The content can be defined in the way appropriate for the credential, byt
* there are three requirements that must be met to work with this API:
* <ul>
* <li>The content must be a CBOR-encoded structure.</li>
* <li>The CBOR structure must be a map.</li>
* <li>The map must contain a tstr key "nameSpaces" whose value contains a map, as described in
* the example below.</li>
* </ul>
*
* <p>If these requirements are not met the {@link InvalidRequestMessageException} exception
* is thrown.
*
* <p>Here's an example of CBOR which conforms to this requirement:
* <pre>
* ItemsRequest = {
* ? "docType" : DocType,
* "nameSpaces" : NameSpaces,
* ? "RequestInfo" : {* tstr => any} ; Additional info the reader wants to provide
* }
*
* DocType = tstr
*
* NameSpaces = {
* + NameSpace => DataElements ; Requested data elements for each NameSpace
* }
*
* NameSpace = tstr
*
* DataElements = {
* + DataElement => IntentToRetain
* }
*
* DataElement = tstr
* IntentToRetain = bool
* </pre>
*
* <p>If the {@code sessionTranscript} parameter is not {@code null}, the X and Y coordinates
* of the public part of the key-pair previously generated by {@link #createEphemeralKeyPair()}
* must appear somewhere in the bytes of the CBOR. Each of these coordinates must appear
* encoded with the most significant bits first and use the exact amount of bits indicated by
* the key size of the ephemeral keys. For example, if the ephemeral key is using the P-256
* curve then the 32 bytes for the X coordinate encoded with the most significant bits first
* must appear somewhere in {@code sessionTranscript} and ditto for the 32 bytes for the Y
* coordinate.
*
* <p>If {@code readerAuth} is not {@code null} it must be the bytes of a {@code COSE_Sign1}
* structure as defined in RFC 8152. For the payload nil shall be used and the
* detached payload is the ReaderAuthenticationBytes CBOR described below.
* <pre>
* ReaderAuthentication = [
* "ReaderAuthentication",
* SessionTranscript,
* ItemsRequestBytes
* ]
*
* ItemsRequestBytes = #6.24(bstr .cbor ItemsRequest)
*
* ReaderAuthenticationBytes = #6.24(bstr .cbor ReaderAuthentication)
* </pre>
*
* <p>where {@code ItemsRequestBytes} are the bytes in the {@code requestMessage} parameter.
*
* <p>The public key corresponding to the key used to make the signature, can be found in the
* {@code x5chain} unprotected header element of the {@code COSE_Sign1} structure (as as
* described in
* <a href="https://tools.ietf.org/html/draft-ietf-cose-x509-04">draft-ietf-cose-x509-04</a>).
* There will be at least one certificate in said element and there may be more (and if so,
* each certificate must be signed by its successor).
*
* <p>Data elements protected by reader authentication are returned if, and only if, they are
* mentioned in {@code requestMessage}, {@code requestMessage} is signed by the top-most
* certificate in the reader's certificate chain, and the data element is configured
* with an {@link AccessControlProfile} configured with an X.509 certificate which appears
* in the certificate chain.
*
* <p>Note that only items referenced in {@code entriesToRequest} are returned - the
* {@code requestMessage} parameter is used only for enforcing reader authentication.
*
* <p>The reason for having {@code requestMessage} and {@code entriesToRequest} as separate
* parameters is that the former represents a request from the remote verifier device
* (optionally signed) and this allows the application to filter the request to not include
* data elements which the user has not consented to sharing.
*
* @param requestMessage If not {@code null}, must contain CBOR data conforming to
* the schema mentioned above.
* @param entriesToRequest The entries to request, organized as a map of namespace
* names with each value being a collection of data elements
* in the given namespace.
* @param readerSignature A {@code COSE_Sign1} structure as described above or
* {@code null} if reader authentication is not being used.
* @return A {@link ResultData} object containing entry data organized by namespace and a
* cryptographically authenticated representation of the same data.
* @throws SessionTranscriptMismatchException Thrown when trying use multiple different
* session transcripts.
* @throws NoAuthenticationKeyAvailableException if authentication keys were never
* provisioned, the method
* {@link #setAvailableAuthenticationKeys(int, int)}
* was called with {@code keyCount} set to 0,
* the method
* {@link #setAllowUsingExhaustedKeys(boolean)}
* was called with {@code false} and all
* available authentication keys have been
* exhausted.
* @throws InvalidReaderSignatureException if the reader signature is invalid, or it
* doesn't contain a certificate chain, or if
* the signature failed to validate.
* @throws InvalidRequestMessageException if the requestMessage is malformed.
* @throws EphemeralPublicKeyNotFoundException if the ephemeral public key was not found in
* the session transcript.
*/
public abstract @NonNull ResultData getEntries(
@Nullable byte[] requestMessage,
@NonNull Map<String, Collection<String>> entriesToRequest,
@Nullable byte[] sessionTranscript,
@Nullable byte[] readerSignature)
throws SessionTranscriptMismatchException, NoAuthenticationKeyAvailableException,
InvalidReaderSignatureException, EphemeralPublicKeyNotFoundException,
InvalidRequestMessageException;
/**
* Sets the number of dynamic authentication keys the {@code IdentityCredential} will maintain,
* and the number of times each should be used.
*
* <p>The Identity Credential system will select the least-used dynamic authentication key each
* time {@link #getEntries(byte[], Map, byte[], byte[])} is called. Identity Credentials
* for which this method has not been called behave as though it had been called wit
* {@code keyCount} 0 and {@code maxUsesPerKey} 1.
*
* @param keyCount The number of active, certified dynamic authentication keys the
* {@code IdentityCredential} will try to keep available. This value
* must be non-negative.
* @param maxUsesPerKey The maximum number of times each of the keys will be used before it's
* eligible for replacement. This value must be greater than zero.
*/
public abstract void setAvailableAuthenticationKeys(int keyCount, int maxUsesPerKey);
/**
* Gets a collection of dynamic authentication keys that need certification.
*
* <p>When there aren't enough certified dynamic authentication keys, either because the key
* count has been increased or because one or more keys have reached their usage count, this
* method will generate replacement keys and certificates and return them for issuer
* certification. The issuer certificates and associated static authentication data must then
* be provided back to the Identity Credential using
* {@link #storeStaticAuthenticationData(X509Certificate, byte[])}. The private part of
* each authentication key never leaves secure hardware.
*
* <p>Each X.509 certificate is signed by CredentialKey. The certificate chain for CredentialKey
* can be obtained using the {@link #getCredentialKeyCertificateChain()} method.
* <p>If the implementation is feature version 202101 or later,
* each X.509 certificate contains an X.509 extension at OID 1.3.6.1.4.1.11129.2.1.26 which
* contains a DER encoded OCTET STRING with the bytes of the CBOR with the following CDDL:
* <pre>
* ProofOfBinding = [
* "ProofOfBinding",
* bstr, // Contains SHA-256(ProofOfProvisioning)
* ]
* </pre>
* <p>This CBOR enables an issuer to determine the exact state of the credential it
* returns issuer-signed data for.
*
* <p> See {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for
* known feature versions.
*
* @return A collection of X.509 certificates for dynamic authentication keys that need issuer
* certification.
*/
public @NonNull abstract Collection<X509Certificate> getAuthKeysNeedingCertification();
/**
* Store authentication data associated with a dynamic authentication key.
*
* This should only be called for an authenticated key returned by
* {@link #getAuthKeysNeedingCertification()}.
*
* @param authenticationKey The dynamic authentication key for which certification and
* associated static
* authentication data is being provided.
* @param staticAuthData Static authentication data provided by the issuer that validates
* the authenticity
* and integrity of the credential data fields.
* @throws UnknownAuthenticationKeyException If the given authentication key is not recognized.
* @deprecated Use {@link #storeStaticAuthenticationData(X509Certificate, Instant, byte[])}
* instead.
*/
@Deprecated
public abstract void storeStaticAuthenticationData(
@NonNull X509Certificate authenticationKey,
@NonNull byte[] staticAuthData)
throws UnknownAuthenticationKeyException;
/**
* Store authentication data associated with a dynamic authentication key.
*
* This should only be called for an authenticated key returned by
* {@link #getAuthKeysNeedingCertification()}.
*
* <p>This is only implemented in feature version 202101 or later. If not implemented, the call
* fails with {@link UnsupportedOperationException}. See
* {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known
* feature versions.
*
* @param authenticationKey The dynamic authentication key for which certification and
* associated static
* authentication data is being provided.
* @param expirationDate The expiration date of the static authentication data.
* @param staticAuthData Static authentication data provided by the issuer that validates
* the authenticity
* and integrity of the credential data fields.
* @throws UnknownAuthenticationKeyException If the given authentication key is not recognized.
*/
public void storeStaticAuthenticationData(
@NonNull X509Certificate authenticationKey,
@NonNull Instant expirationDate,
@NonNull byte[] staticAuthData)
throws UnknownAuthenticationKeyException {
throw new UnsupportedOperationException();
}
/**
* Get the number of times the dynamic authentication keys have been used.
*
* @return int array of dynamic authentication key usage counts.
*/
public @NonNull abstract int[] getAuthenticationDataUsageCount();
/**
* Proves ownership of a credential.
*
* <p>This method returns a COSE_Sign1 data structure signed by the CredentialKey
* with payload set to {@code ProofOfDeletion} as defined below.</p>
*
* <p>The returned CBOR is the following:</p>
* <pre>
* ProofOfOwnership = [
* "ProofOfOwnership", ; tstr
* tstr, ; DocType
* bstr, ; Challenge
* bool ; true if this is a test credential, should
* ; always be false.
* ]
* </pre>
*
* <p>This is only implemented in feature version 202101 or later. If not implemented, the call
* fails with {@link UnsupportedOperationException}. See
* {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known
* feature versions.
*
* @param challenge is a non-empty byte array whose contents should be unique, fresh and
* provided by the issuing authority. The value provided is embedded in the
* generated CBOR and enables the issuing authority to verify that the
* returned proof is fresh.
* @return the COSE_Sign1 data structure above
*/
public @NonNull byte[] proveOwnership(@NonNull byte[] challenge) {
throw new UnsupportedOperationException();
}
/**
* Deletes a credential.
*
* <p>This method returns a COSE_Sign1 data structure signed by the CredentialKey
* with payload set to {@code ProofOfDeletion} as defined below.</p>
*
* <pre>
* ProofOfDeletion = [
* "ProofOfDeletion", ; tstr
* tstr, ; DocType
* bstr, ; Challenge
* bool ; true if this is a test credential, should
* ; always be false.
* ]
* </pre>
*
* <p>This is only implemented in feature version 202101 or later. If not implemented, the call
* fails with {@link UnsupportedOperationException}. See
* {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known
* feature versions.
*
* @param challenge is a non-empty byte array whose contents should be unique, fresh and
* provided by the issuing authority. The value provided is embedded in the
* generated CBOR and enables the issuing authority to verify that the
* returned proof is fresh.
* @return the COSE_Sign1 data structure above
*/
public @NonNull byte[] delete(@NonNull byte[] challenge) {
throw new UnsupportedOperationException();
}
/**
* Updates the credential with new access control profiles and data items.
*
* <p>This method is similar to
* {@link WritableIdentityCredential#personalize(PersonalizationData)} except that it operates
* on an existing credential, see the documentation for that method for the format of the
* returned data.
*
* <p>If this call succeeds an side-effect is that all dynamic authentication keys for the
* credential are deleted. The application will need to use
* {@link #getAuthKeysNeedingCertification()} to generate replacement keys and return
* them for issuer certification.
*
* <p>This is only implemented in feature version 202101 or later. If not implemented, the call
* fails with {@link UnsupportedOperationException}. See
* {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known
* feature versions.
*
* @param personalizationData The data to update, including access control profiles
* and data elements and their values, grouped into namespaces.
* @return A COSE_Sign1 data structure, see above.
*/
public @NonNull byte[] update(@NonNull PersonalizationData personalizationData) {
throw new UnsupportedOperationException();
}
}