Dimethyllysergamide: Difference between revisions
Appearance
Content deleted Content added
Entranced98 (talk | contribs) +sd |
|||
(44 intermediate revisions by 29 users not shown) | |||
Line 1: | Line 1: | ||
{{short description|Chemical compound}} |
|||
'''N,N-Dimethyllysergamide''' (DAM-57) is a derivative of [[ergine]]. |
|||
{{Drugbox |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 447574383 |
|||
| IUPAC_name = (6a''R'',9''R'')-''N'',''N''-dimethyl-7-methyl-4,6,6a,7,8,9- hexahydroindolo- [4,3-fg] quinoline- 9-carboxamide |
|||
| image = DAM-57.svg |
|||
<!--Clinical data--> |
|||
It may cause LSD-like effects at doses of 1 milligram or more but this is disputed. |
|||
| tradename = |
|||
| legal_AU = |
|||
| legal_CA = |
|||
| legal_UK = |
|||
| legal_US = Schedule I |
|||
| legal_US_comment = Controlled in the United States via the [[Federal Analog Act]] but only if it is intended for human consumption. |
|||
| routes_of_administration = [[Wiktionary:oral|Oral]] |
|||
<!--Pharmacokinetic data--> |
|||
[[Image:DAM-57.png]] |
|||
| metabolism = hepatic |
|||
| excretion = renal |
|||
<!--Identifiers--> |
|||
{{hallucinogenic lysergamides}} |
|||
| PubChem = 199478 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 172668 |
|||
| CAS_number = 4238-84-0 |
|||
| CAS_number_Ref = {{Cascite|correct|CAS}} |
|||
<!--Chemical data--> |
|||
| C=18 | H=21 | N=3 | O=1 |
|||
| smiles = O=C(N(C)C)[C@@H]3C=C2c4cccc1c4c(c[nH]1)C[C@H]2N(C3)C |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C18H21N3O/c1-20(2)18(22)12-7-14-13-5-4-6-15-17(13)11(9-19-15)8-16(14)21(3)10-12/h4-7,9,12,16,19H,8,10H2,1-3H3/t12-,16-/m1/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = FWHSERNVTGTIJE-MLGOLLRUSA-N |
|||
| synonyms = DAM-57, Lysergic acid dimethylamide |
|||
}} |
|||
'''''N,N''-Dimethyllysergamide''' or '''''N,N''-dimethyl-D-lysergamide''' ('''DAM-57''') is a [[Derivative (chemistry)|derivative]] of [[ergine]]. There has been a single report of observing N,N-dimethyl-D-lysergamide in the illicit drug market.<ref>{{cite journal | vauthors = Clark AB | title = Lysergic Acid Diethylamide and Lysergic Acid Dimethylamide| journal = Microgram | volume = 6 | pages = 37 | date = 1973 }}</ref> This compound did induce autonomic disturbances at oral levels of some ten times the dosage required for [[LSD]], presumably in the high hundreds of micrograms. There is some disagreement as to whether there were psychic changes observed.<ref>{{CiteTiHKAL|pages=26|name-list-style=vanc}}; {{cite web | title = #26. LSD-25 | url = https://www.erowid.org/library/books_online/tihkal/tihkal26.shtml | work = Erowid }}</ref> |
|||
==References== |
|||
{{Reflist}} |
|||
{{Hallucinogens}} |
|||
{{Ergolines}} |
|||
[[Category:Psychedelics]] |
|||
[[Category:Lysergamides]] |
[[Category:Lysergamides]] |
||
{{hallucinogen-stub}} |
Latest revision as of 13:03, 13 January 2023
Clinical data | |
---|---|
Other names | DAM-57, Lysergic acid dimethylamide |
Routes of administration | Oral |
Legal status | |
Legal status |
|
Pharmacokinetic data | |
Metabolism | hepatic |
Excretion | renal |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C18H21N3O |
Molar mass | 295.386 g·mol−1 |
3D model (JSmol) | |
| |
| |
(verify) |
N,N-Dimethyllysergamide or N,N-dimethyl-D-lysergamide (DAM-57) is a derivative of ergine. There has been a single report of observing N,N-dimethyl-D-lysergamide in the illicit drug market.[1] This compound did induce autonomic disturbances at oral levels of some ten times the dosage required for LSD, presumably in the high hundreds of micrograms. There is some disagreement as to whether there were psychic changes observed.[2]
References[edit]
- ^ Clark AB (1973). "Lysergic Acid Diethylamide and Lysergic Acid Dimethylamide". Microgram. 6: 37.
- ^ Shulgin A, Shulgin A (September 1997). TiHKAL: The Continuation. Berkeley, California: Transform Press. p. 26. ISBN 0-9630096-9-9. OCLC 38503252.; "#26. LSD-25". Erowid.