Melam (chemistry): Difference between revisions
Appearance
Content deleted Content added
Updating {{chembox}} (no changed fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report |
m Added UNII |
||
(10 intermediate revisions by 8 users not shown) | |||
Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
| Name = Melam |
| Name = Melam |
||
| ImageFile = Melam. |
| ImageFile = Melam.svg |
||
| ImageAlt = Skeletal formula of melam |
|||
| ImageSize = 200px |
|||
| ImageFile1 = Melam-3D-balls.png |
|||
| ImageAlt1 = Ball-and-stick model of the melam molecule |
|||
| IUPACName = ''N2''-(4,6-Diamino-1,3,5-triazin-2-yl)-1,3,5-triazine-2,4,6-triamine |
| IUPACName = ''N2''-(4,6-Diamino-1,3,5-triazin-2-yl)-1,3,5-triazine-2,4,6-triamine |
||
| OtherNames = A1,3,5-Triazine-2,4,6-triamine |
| OtherNames = A1,3,5-Triazine-2,4,6-triamine |
||
| |
|Section1={{Chembox Identifiers |
||
| Abbreviations = |
| Abbreviations = |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 3576-88-3 |
| CASNo = 3576-88-3 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| EINECS = |
|||
| UNII = 763B6VP74S |
|||
| PubChem =77125 |
|||
| |
| EINECS = 222-695-1 |
||
| |
| PubChem = 77125 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 69563 |
|||
| SMILES = C1(=NC(=NC(=N1)NC2=NC(=NC(=N2)N)N)N)N |
|||
| InChI = 1/C6H9N11/c7-1-11-2(8)14-5(13-1)17-6-15-3(9)12-4(10)16-6/h(H9,7,8,9,10,11,12,13,14,15,16,17) |
|||
| InChIKey = YZEZMSPGIPTEBA-UHFFFAOYAX |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C6H9N11/c7-1-11-2(8)14-5(13-1)17-6-15-3(9)12-4(10)16-6/h(H9,7,8,9,10,11,12,13,14,15,16,17) |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = YZEZMSPGIPTEBA-UHFFFAOYSA-N |
|||
| RTECS = |
| RTECS = |
||
| MeSHName = |
| MeSHName = |
||
Line 19: | Line 33: | ||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = |
| KEGG = |
||
}} |
|||
| ATCCode_prefix = |
|||
⚫ | |||
| ATCCode_suffix = |
|||
| ATC_Supplemental =}} |
|||
⚫ | |||
| Formula = C<sub>6</sub>H<sub>9</sub>N<sub>11</sub> |
| Formula = C<sub>6</sub>H<sub>9</sub>N<sub>11</sub> |
||
| MolarMass = 235.21 g/mol |
| MolarMass = 235.21 g/mol |
||
Line 28: | Line 40: | ||
| Density = |
| Density = |
||
| MeltingPt = |
| MeltingPt = |
||
| |
| MeltingPt_notes = |
||
| BoilingPt = |
| BoilingPt = |
||
| |
| BoilingPt_notes = |
||
| Solubility = insoluble |
| Solubility = insoluble |
||
| SolubleOther = slightly soluble in acids |
| SolubleOther = slightly soluble in acids |
||
Line 36: | Line 48: | ||
| pKa = |
| pKa = |
||
| pKb = }} |
| pKb = }} |
||
| |
|Section7={{Chembox Hazards |
||
| EUClass = |
|||
| EUIndex = |
|||
| MainHazards = |
| MainHazards = |
||
| NFPA-H = |
| NFPA-H = |
||
| NFPA-F = |
| NFPA-F = |
||
| NFPA-R = |
| NFPA-R = |
||
| NFPA- |
| NFPA-S = |
||
| RPhrases = |
|||
| SPhrases = |
|||
| RSPhrases = |
|||
| FlashPt = |
| FlashPt = |
||
| |
| AutoignitionPt = |
||
| ExploLimits = |
| ExploLimits = |
||
| PEL = }} |
| PEL = }} |
||
Line 67: | Line 74: | ||
[[Category:Triazines]] |
[[Category:Triazines]] |
||
[[Category:Secondary amines]] |
|||
[[ |
[[Category:Polyamines]] |