Theodrenaline: Difference between revisions
Appearance
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_ |
Improvements, formatting. |
||
(30 intermediate revisions by 17 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound used as a cardiac stimulant}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
⚫ | |||
| image = |
| image = Theodrenaline.png |
||
| width = 250px |
|||
<!--Clinical data--> |
<!-- Clinical data --> |
||
| tradename = |
| tradename = |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
||
| legal_CA = <!-- |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
| legal_UK = <!-- GSL |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
||
| legal_US = <!-- OTC |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!-- Pharmacokinetic data --> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!-- Identifiers --> |
||
| CAS_number = |
| CAS_number = 13460-98-5 |
||
| ATC_prefix = C01 |
| ATC_prefix = C01 |
||
| ATC_suffix = CA23 |
| ATC_suffix = CA23 |
||
| PubChem = 71857 |
| PubChem = 71857 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = DB12927 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = RW8PD99T8G |
| UNII = RW8PD99T8G |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D07155 |
| KEGG = D07155 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 64874 |
|||
| ChEBI = 135580 |
|||
| ChEMBL = 2107608 |
|||
| synonyms = Noradrenalinoethyltheophylline; Noradrenaline theophylline |
|||
<!--Chemical data--> |
<!-- Chemical data --> |
||
⚫ | |||
| C=17 | H=21 | N=5 | O=5 |
| C=17 | H=21 | N=5 | O=5 |
||
| SMILES = Cn1c2c(c(=O)n(c1=O)C)n(cn2)CCNCC(c3ccc(c(c3)O)O)O |
|||
| molecular_weight = 375.379 g/mol |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C17H21N5O5/c1-20-15-14(16(26)21(2)17(20)27)22(9-19-15)6-5-18-8-13(25)10-3-4-11(23)12(24)7-10/h3-4,7,9,13,18,23-25H,5-6,8H2,1-2H3 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = WMCMJIGLYZDKRN-UHFFFAOYSA-N |
|||
}} |
}} |
||
'''Theodrenaline''' ({{Abbrlink|INN|International Nonproprietary Name}}), also known as '''noradrenalinoethyltheophylline''' or as '''noradrenaline theophylline''', is a chemical linkage of [[norepinephrine (medication)|norepinephrine]] (noradrenaline) and [[theophylline]] used as a [[cardiac stimulant]].<ref name="pmid16633089">{{cite journal | vauthors = Usichenko TI, Foellner S, Gruendling M, Feyerherd F, Lehmann C, Wendt M, Pavlovic D | title = Akrinor-induced relaxation of pig coronary artery in vitro is transformed into alpha1-adrenoreceptor-mediated contraction by pretreatment with propranolol | journal = Journal of Cardiovascular Pharmacology | volume = 47 | issue = 3 | pages = 450–5 | date = March 2006 | pmid = 16633089 | doi = 10.1097/01.fjc.0000211710.87863.89 | s2cid = 20221167 | url = https://journals.lww.com/cardiovascularpharm/fulltext/2006/03000/akrinor_induced_relaxation_of_pig_coronary_artery.17.aspx | doi-access = free }}</ref><ref name="IndexNominum2000">{{cite book | author=Schweizerischer Apotheker-Verein | title=Index Nominum 2000: International Drug Directory | publisher=Medpharm Scientific Publishers | series=Index nominum | year=2000 | isbn=978-3-88763-075-1 | url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA1011 | access-date=29 August 2024 | pages=157,1011}}</ref> It is sometimes combined with [[cafedrine]].<ref name="pmid16633089" /><ref name="IndexNominum2000" /> |
|||
'''Theodrenaline''' (or '''noradrenaline theophylline''') is a cardiac stimulant. |
|||
==See also== |
|||
It is sometimes combined with [[cafedrine]].<ref name="pmid16633089">{{cite journal |author=Usichenko TI |title=Akrinor-induced relaxation of pig coronary artery in vitro is transformed into alpha1-adrenoreceptor-mediated contraction by pretreatment with propranolol |journal=J. Cardiovasc. Pharmacol. |volume=47 |issue=3 |pages=450–5 |year=2006 |month=March |pmid=16633089 |doi=10.1097/01.fjc.0000211710.87863.89 |url=http://meta.wkhealth.com/pt/pt-core/template-journal/lwwgateway/media/landingpage.htm?an=00005344-200603000-00017 |author-separator=, |author2=Foellner S |author3=Gruendling M |display-authors=3 |last4=Feyerherd |first4=F |last5=Lehmann |first5=C |last6=Wendt |first6=M |last7=Pavlovic |first7=D}}</ref> |
|||
* [[Cafedrine]] |
|||
* [[Fenethylline]] |
|||
* [[Theophylline ephedrine]] |
|||
==References== |
==References== |
||
{{ |
{{Reflist}} |
||
{{Cardiac stimulants excluding cardiac glycosides}} |
{{Cardiac stimulants excluding cardiac glycosides}} |
||
{{Adenosine receptor modulators}} |
|||
{{Adrenergic receptor modulators}} |
|||
[[Category:Adenosine receptor antagonists]] |
|||
[[Category:Antihypotensive agents]] |
|||
[[Category:Catecholamines]] |
[[Category:Catecholamines]] |
||
[[Category:Cardiac stimulants]] |
[[Category:Cardiac stimulants]] |
||
[[Category:Phenylethanolamines]] |
|||
[[Category:Xanthines]] |
[[Category:Xanthines]] |
||
{{ |
{{Cardiovascular-drug-stub}} |