Theodrenaline: Difference between revisions

{{Short description|Chemical compound used as a cardiac stimulant}}

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451115553

| image = Theodrenaline.png

| width = 250px

<!-- Clinical data -->

| tradename =

| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category =

| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->

| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| legal_status =

| routes_of_administration =

<!-- Pharmacokinetic data -->

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

<!-- Identifiers -->

| CAS_number = 13460-98-5

| DrugBank = DB12927

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 64874

| ChEBI = 135580

| ChEMBL = 2107608

| synonyms = Noradrenalinoethyltheophylline; Noradrenaline theophylline

<!-- Chemical data -->

| IUPAC_name = (''RS'')-7-(2-<nowiki/>{[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino}ethyl)-1,3-dimethyl-3,7-dihydro-1''H''-purine-2,6-dione

| SMILES = Cn1c2c(c(=O)n(c1=O)C)n(cn2)CCNCC(c3ccc(c(c3)O)O)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C17H21N5O5/c1-20-15-14(16(26)21(2)17(20)27)22(9-19-15)6-5-18-8-13(25)10-3-4-11(23)12(24)7-10/h3-4,7,9,13,18,23-25H,5-6,8H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = WMCMJIGLYZDKRN-UHFFFAOYSA-N

'''Theodrenaline''' ({{Abbrlink|INN|International Nonproprietary Name}}), also known as '''noradrenalinoethyltheophylline''' or as '''noradrenaline theophylline''', is a chemical linkage of [[norepinephrine (medication)|norepinephrine]] (noradrenaline) and [[theophylline]] used as a [[cardiac stimulant]].<ref name="pmid16633089">{{cite journal | vauthors = Usichenko TI, Foellner S, Gruendling M, Feyerherd F, Lehmann C, Wendt M, Pavlovic D | title = Akrinor-induced relaxation of pig coronary artery in vitro is transformed into alpha1-adrenoreceptor-mediated contraction by pretreatment with propranolol | journal = Journal of Cardiovascular Pharmacology | volume = 47 | issue = 3 | pages = 450–5 | date = March 2006 | pmid = 16633089 | doi = 10.1097/01.fjc.0000211710.87863.89 | s2cid = 20221167 | url = https://journals.lww.com/cardiovascularpharm/fulltext/2006/03000/akrinor_induced_relaxation_of_pig_coronary_artery.17.aspx | doi-access = free }}</ref><ref name="IndexNominum2000">{{cite book | author=Schweizerischer Apotheker-Verein | title=Index Nominum 2000: International Drug Directory | publisher=Medpharm Scientific Publishers | series=Index nominum | year=2000 | isbn=978-3-88763-075-1 | url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA1011 | access-date=29 August 2024 | pages=157,1011}}</ref> It is sometimes combined with [[cafedrine]].<ref name="pmid16633089" /><ref name="IndexNominum2000" />

==See also==

* [[Cafedrine]]

* [[Fenethylline]]

* [[Theophylline ephedrine]]

{{Reflist}}

{{Adenosine receptor modulators}}

{{Adrenergic receptor modulators}}

[[Category:Adenosine receptor antagonists]]

[[Category:Antihypotensive agents]]

[[Category:Phenylethanolamines]]

{{Cardiovascular-drug-stub}}