Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Flutazolam: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456890075 of page Flutazolam for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
removed Category:Fluoroarenes; added Category:2-Fluorophenyl compounds using HotCat |
||
Line 1: | Line 1: | ||
{{Short description|Benzodiazepam}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Flutazolam|oldid=456890075}} 456890075] of page [[Flutazolam]] with values updated to verified values.}} |
|||
{{distinguish|Fluetizolam}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 461102637 |
||
| IUPAC_name = 10-chloro- |
| IUPAC_name = 10-chloro-11''b''-(2-fluorophenyl)-7-(2-hydroxyethyl)-3,5-dihydro-2''H''-[1,3]oxazolo[3,2-''d''][1,4]benzodiazepin-6-one |
||
| image = Flutazolam.svg |
| image = Flutazolam.svg |
||
| width = |
| width = 155 |
||
| image2 = Flutazolam ball-and-stick.png |
|||
| width2 = 160 |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = Coreminal <small>([[Japan|JP]])</small> |
||
| Drugs.com = {{drugs.com|international|flutazolam}} |
| Drugs.com = {{drugs.com|international|flutazolam}} |
||
| legal_US = Unscheduled |
|||
| legal_status = |
|||
| legal_status = In general: unscheduled, Rx-only in Japan |
|||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| metabolism = |
| metabolism = Hepatic |
||
| elimination_half-life = |
| elimination_half-life = 3.5 hours (parent compound); 47-100 hours (major metabolite) |
||
| routes_of_administration = Oral |
|||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite| |
| CAS_number_Ref = {{cascite|changed|??}} |
||
| CAS_number = |
| CAS_number = 27060-91-9 |
||
| ATC_prefix = |
| ATC_prefix = |
||
| PubChem = 3398 |
| PubChem = 3398 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 3281 |
| ChemSpiderID = 3281 |
||
| UNII_Ref = {{fdacite| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 5G2K7O5D8S |
| UNII = 5G2K7O5D8S |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D01286 |
| KEGG = D01286 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 1697836 |
||
⚫ | |||
<!--Chemical data--> |
|||
| molecular_weight = 376.809 |
|||
⚫ | |||
| smiles = Fc1ccccc1C42OCCN2CC(=O)N(c3c4cc(Cl)cc3)CCO |
| smiles = Fc1ccccc1C42OCCN2CC(=O)N(c3c4cc(Cl)cc3)CCO |
||
| InChI = 1/C19H18ClFN2O3/c20-13-5-6-17-15(11-13)19(14-3-1-2-4-16(14)21)22(8-10-26-19)12-18(25)23(17)7-9-24/h1-6,11,24H,7-10,12H2 |
|||
| InChIKey = WMFSSTNVXWNLKI-UHFFFAOYAC |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C19H18ClFN2O3/c20-13-5-6-17-15(11-13)19(14-3-1-2-4-16(14)21)22(8-10-26-19)12-18(25)23(17)7-9-24/h1-6,11,24H,7-10,12H2 |
| StdInChI = 1S/C19H18ClFN2O3/c20-13-5-6-17-15(11-13)19(14-3-1-2-4-16(14)21)22(8-10-26-19)12-18(25)23(17)7-9-24/h1-6,11,24H,7-10,12H2 |
||
Line 43: | Line 48: | ||
| synonyms = <small>13-chloro- 2-(2-fluorophenyl)- 9-(2-hydroxyethyl)- 3-oxa- 6,9-diazatricyclo[8.4.0.0<sup>2,6</sup>] tetradeca-1(10),11,13- trien- 8-one</small> |
| synonyms = <small>13-chloro- 2-(2-fluorophenyl)- 9-(2-hydroxyethyl)- 3-oxa- 6,9-diazatricyclo[8.4.0.0<sup>2,6</sup>] tetradeca-1(10),11,13- trien- 8-one</small> |
||
}} |
}} |
||
'''Flutazolam'''<ref>{{cite patent | country = DE | number = 1952486 }}</ref> ('''Coreminal''', MS-4101) is a drug which is a [[benzodiazepine]] derivative. It was invented in Japan, and this is the main country in which it has been used medically. It has [[sedative]], [[muscle relaxant]], [[anticonvulsant]], and [[anxiolytic]] effects similar to those produced by other benzodiazepine derivatives, and though it is around the same potency as [[diazepam]], it produces a more marked sedation and impaired coordination. It is indicated for the treatment of [[insomnia]].<ref>Mitsushima T, Ueki S. Psychopharmacological effects of flutazolam (MS-4101). ''Nippon Yakurigaku Zasshi''. 1978 Nov;74(8):959-79. (Japanese).</ref> Its major active metabolite is n-[[desalkylflurazepam]], also known as norflurazepam, which is also a principal metabolite of [[flurazepam]] (trade name Dalmane).<ref>{{cite journal | vauthors = Miyaguchi H, Kuwayama K, Tsujikawa K, Kanamori T, Iwata YT, Inoue H, Kishi T | title = A method for screening for various sedative-hypnotics in serum by liquid chromatography/single quadrupole mass spectrometry | journal = Forensic Science International | volume = 157 | issue = 1 | pages = 57–70 | date = February 2006 | pmid = 15869852 | doi = 10.1016/j.forsciint.2005.03.011 }}</ref> While flutazolam has a very short half-life of only 3.5 hours, n-desalkylflurazepam has a long half-life of between 47–100 hours.<ref name="Prescribing Information for Dalmane">{{cite web |title=Dalmane Prescribing Information |url=https://www.accessdata.fda.gov/drugsatfda_docs/label/2007/016721s076lbl.pdf |website=Prescribing Information for Dalmane |publisher=FDA |access-date=3 April 2022}}</ref> |
|||
Flutazolam is closely related in structure to another benzodiazepine, [[haloxazolam]].<ref>{{cite journal | vauthors = Kuwayama T, Kurono Y, Muramatsu T, Yashiro T, Ikeda K | title = The behavior of 1,4-benzodiazepine drugs in acidic media. V. Kinetics of hydrolysis of flutazolam and haloxazolam in aqueous solution. | journal = Chemical and Pharmaceutical Bulletin | date = January 1986 | volume = 34 | issue = 1 | pages = 320–6 | doi = 10.1248/cpb.34.320 | pmid = 2870816 | doi-access = free }}</ref><ref name="pmid2894449">{{cite journal | vauthors = Yashiro T, Kuwayama T, Kawazura H, Suzuki T | title = [The behavior of 1,4-benzodiazepine drugs in acidic media. IX. Effect of hydrolyzate of flutazolam on the central nervous system] | language = ja | journal = Yakugaku Zasshi: Journal of the Pharmaceutical Society of Japan | volume = 107 | issue = 10 | pages = 830–4 | date = October 1987 | pmid = 2894449 | doi = 10.1248/yakushi1947.107.10_830 | doi-access = free }}</ref> |
|||
== See also == |
|||
*[[Benzodiazepine]] |
|||
*[[Flurazepam]] |
|||
*N-[[desalkylflurazepam]] |
|||
== References == |
|||
{{reflist}} |
|||
{{Benzodiazepines}} |
|||
{{GABAAR PAMs}} |
|||
[[Category:Primary alcohols]] |
|||
[[Category:Chloroarenes]] |
|||
[[Category:GABAA receptor positive allosteric modulators]] |
|||
[[Category:Lactams]] |
|||
[[Category:2-Fluorophenyl compounds]] |
|||
[[Category:Oxazolobenzodiazepines]] |