[go: nahoru, domu]
Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Olsalazine: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{drugbox}} taken from revid 456763669 of page Olsalazine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'KEGG').
 
no longer a stub
 
Line 1: Line 1:
{{Short description|Pharmaceutical drug}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Olsalazine|oldid=456763669}} 456763669] of page [[Olsalazine]] with values updated to verified values.}}
{{more citations needed|date=January 2021}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Verifiedfields = changed
| verifiedrevid = 402512533
| verifiedrevid = 462265233
⚫
| image = Olsalazine.svg
| IUPAC_name = 5-[(2''Z'')-2-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazino]-2-hydroxybenzoic acid
⚫
| image = Olsalazine.png


<!--Clinical data-->
<!--Clinical data-->
| tradename = Dipentum
| tradename = Dipentum
| Drugs.com = {{drugs.com|monograph|dipentum}}
| Drugs.com = {{drugs.com|monograph|olsalazine-sodium}}
| MedlinePlus = a601088
| MedlinePlus = a601088
| DailyMedID = Olsalazine
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = C
| pregnancy_US = C<!-- A / B / C / D / X -->
| pregnancy_AU_comment = <ref name="Drugs.com pregnancy">{{cite web | title=Olsalazine (Dipentum) Use During Pregnancy | website=Drugs.com | date=6 September 2019 | url=https://www.drugs.com/pregnancy/olsalazine.html | access-date=9 October 2020}}</ref>
⚫
| pregnancy_category =
| pregnancy_US = C
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| pregnancy_US_comment = <ref name="Drugs.com pregnancy" />
⚫
| pregnancy_category =
| legal_AU = S4
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_UK = POM
| legal_US = Rx-only<!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US = Rx-only
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration = [[Oral administration|By mouth]]
| ATC_prefix = A07
⚫
| ATC_suffix = EC03


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound = 99%
| protein_bound = 99%
| metabolism =
| metabolism =
| elimination_half-life = 0.9 hours
| elimination_half-life = 0.9 hours
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| index2_label = as salt
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 15722-48-2
| CAS_number = 15722-48-2
| ATC_prefix = A07
| PubChem = 22419
⚫
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| ATC_suffix = EC03
| PubChem = 6003770
⚫
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB01250
| DrugBank = DB01250
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
Line 41: Line 44:
| UNII = ULS5I8J03O
| UNII = ULS5I8J03O
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = <!-- blanked - oldvalue: D00727 -->
| KEGG = D08295
| KEGG2_Ref = {{keggcite|changed|kegg}}
| KEGG2 = D00727
| ChEBI_Ref =
| ChEBI =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 571540 -->
| ChEMBL = 425
| NIAID_ChemDB =
| chemical_formula =
| C=14 | H=10 | N=2 | O=6
| PDB_ligand =
| synonyms =
| molecular_weight = 302.239g/mol

<!--Chemical data-->
| C=14 | H=10 | N=2 | O=6
| smiles = O=C(O)c1cc(ccc1O)/N=N/c2cc(C(O)=O)c(O)cc2
| smiles = O=C(O)c1cc(ccc1O)/N=N/c2cc(C(O)=O)c(O)cc2
| InChI = 1/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+
| InChIKey = QQBDLJCYGRGAKP-FOCLMDBBBJ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+
| StdInChI = 1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+
Line 55: Line 63:
| StdInChIKey = QQBDLJCYGRGAKP-FOCLMDBBSA-N
| StdInChIKey = QQBDLJCYGRGAKP-FOCLMDBBSA-N
}}
}}

'''Olsalazine''' is an anti-inflammatory medication used in the treatment of [[ulcerative colitis]].<ref name="pmid2131213">{{cite journal | vauthors = | title = Olsalazine--a further choice in ulcerative colitis | journal = Drug and Therapeutics Bulletin | volume = 28 | issue = 15 | pages = 57–8 | date = July 1990 | pmid = 2131213 | doi = 10.1136/dtb.28.15.57 | s2cid = 7178709 }}</ref><ref name="pmid1711964">{{cite journal | vauthors = Wadworth AN, Fitton A | title = Olsalazine. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic potential in inflammatory bowel disease | journal = Drugs | volume = 41 | issue = 4 | pages = 647–64 | date = April 1991 | pmid = 1711964 | doi = 10.2165/00003495-199141040-00009 | s2cid = 243654426 }}</ref> It is sold under the brand name '''Dipentum'''.<ref name=Med1>{{cite web |title=Olsalazine Sodium 250 mg Capsules - Summary of Product Characteristics (SmPC) - (emc) |url=https://www.medicines.org.uk/emc/product/3708/smpc#gref |website=www.medicines.org.uk |access-date=9 January 2021}}</ref>

Olsalazine itself is a pro-drug of [[mesalazine]] (5-aminosalicyclic acid or 5-ASA) and is not absorbed in the small intestine. Instead it continues through to the colon where it is cleaved into two molecules of 5-ASA by [[azoreductases]] produced by colonic bacteria. Olsalazine thus exerts its anti-inflammatory effect by its colonic breakdown into 5-ASA which inhibits cyclooxygenase and lipoxygenase thereby reducing prostaglandin and leukotriene production.<ref name=Med1/>

==History==
Olsalazine gained [[Food and Drug Administration]] (FDA) approval in 1990.

==Supply==
The drug is supplied by [[UCB (company)|UCB Pharma]].

==Research==
In 2006 the Australian biotech company [[Giaconda (pharmaceutical company)|Giaconda]] received a European patent for a combination therapy for treating constipation-predominant [[irritable bowel syndrome]] that uses olsalazine and the anti-[[gout]] drug [[colchicine]], for trials the following year.<ref>{{cite news |title=Giaconda gets European patent for drug |url=https://www.smh.com.au/business/giaconda-gets-european-patent-for-drug-20061228-gdp4vv.html |access-date=16 January 2021 |work=The Sydney Morning Herald |date=28 December 2006 |language=en}}</ref>

== References ==
{{reflist}}

{{Antidiarrheals, intestinal anti-inflammatory/anti-infective agents}}
{{Portal bar | Medicine}}

[[Category:Gastroenterology]]
[[Category:Hydrazones]]
[[Category:Salicylic acids]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"