5-MeO-2-TMT: Difference between revisions

{{drugbox | verifiedrevid = 399333546

|

| InChI = 1/C14H20N2O/c1-10-12(7-8-16(2)3)13-9-11(17-4)5-6-14(13)15-10/h5-6,9,15H,7-8H2,1-4H3

| InChIKey = ACEHBQPPDDGCGZ-UHFFFAOYAA

| smiles1 = O(c1cc2c(cc1)nc(c2CCN(C)C)C)C

| CAS_number = 67292-68-6

| ATC_prefix =

| ATC_suffix =

| PubChem = 49756

| C=14 | H=20 | N=2 | O=1

| molecular_weight = 232.321 g/mol

| smiles = CC1=C(C2=C(N1)C=CC(=C2)OC)CCN(C)C

| melting_point =

| melting_high =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

'''5-Methoxy-2,''N'',''N''-trimethyltryptamine''' ('''5-MeO-2,''N'',''N''-TMT''', '''5-MeO-TMT''') is a [[psychoactive drug]] of the [[tryptamine]] [[chemical class]] which acts as a [[psychedelic drug|psychedelic]]. It was first [[chemical synthesis|synthesized]] by [[Alexander Shulgin]] and reported in his book [[TiHKAL]] ("Tryptamines i Have Known And Loved").<ref>[http://www.erowid.org/library/books_online/tihkal/tihkal45.shtml Erowid Online Books : "TIHKAL" - #45 5-MEO-TMT]</ref> 5-MeO-TMT is claimed to show psychoactive effects at a dosage of 75-150&nbsp;mg orally, but these are relatively mild compared to those of other similar [[chemical compound|compound]]s. This suggests that while the [[methyl]] [[functional group|group]] on the 2-position of the [[molecule]] has impaired the [[binding (molecular)|binding]] of [[metabolic]] [[enzyme]]s like [[monoamine oxidase]] (MAO), it is also interfering with binding to and/or activation of the [[serotonin]] [[5-HT2A|5-HT_2A]] [[Receptor (biochemistry)|receptor]], the target responsible for mediating the [[hallucinogen]]ic effects of such compounds.

{{TiHKAL}}

{{DEFAULTSORT:5-Methoxy-2,N,N-Trimethyltryptamine}}