[go: nahoru, domu]

Jump to content

Xylulose: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
add qualifer.
No edit summary
 
(48 intermediate revisions by 32 users not shown)
Line 1: Line 1:
{{chembox
{{Chembox new
| Verifiedfields = changed
| Reference = <ref>Data is for L-xylulose.</ref><ref>''Merck Index'', 11th Edition, '''9996'''.</ref>
| verifiedrevid = 470634402
| ImageFileL1 = L-xylulose.png
| Reference = <ref>Data is for L-xylulose.</ref><ref>''Merck Index'', 11th Edition, '''9996'''.</ref>
| ImageSizeL1 =
| ImageFileR1 = xylulose.png
| ImageFile1 = Xylulose.png
| ImageFileL2 = Alpha-D-Xylulofuranose.svg
| ImageSizeR1 = 150px
| ImageFileR2 = Beta-D-Xylulofuranose.svg
| IUPACName = (''3R,4S'')-1,3,4,5-Tetrahydroxypentan-2-one
| SystematicName = (''3R,4S'')-1,3,4,5-Tetrahydroxypentan-2-one
| OtherNames = threo-Pentulose<br>threo-2-Pentulose
| IUPACName = <small>L</small>-''threo''-Pent-2-ulose
| Section1 = {{Chembox Identifiers
| OtherNames = threo-Pentulose<br />threo-2-Pentulose<small>L</small>-Xylulose
| CASNo = 527-50-4
| Section1 = {{Chembox Identifiers
| PubChem = 22253
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| SMILES = C([C@@H]([C@H](C(=O)CO)O)O)O
| ChemSpiderID = 20892
}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| Section2 = {{Chembox Properties
| StdInChI = 1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m0/s1
| Formula = C<sub>5</sub>H<sub>10</sub>O<sub>5</sub>
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| MolarMass = 150.13 g/mol
| StdInChIKey = ZAQJHHRNXZUBTE-WVZVXSGGSA-N
| Appearance = Syrup
| InChI = 1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m0/s1
| Density =
| InChIKey1 = ZAQJHHRNXZUBTE-WVZVXSGGSA-N
| MeltingPt =
| CASNo = 5962-29-8
| BoilingPt =
| CASNo_Ref = {{cascite|correct|CAS}}
| Solubility =
| CASNo_Comment = (<small>D</small>/<small>L</small>)
}}
| CASNo1 = 551-84-8
| Section3 = {{Chembox Hazards
| CASNo1_Ref = {{cascite|correct|CAS}}
| MainHazards =
| CASNo1_Comment = (<small>D</small>)
| FlashPt =
| CASNo2 = 527-50-4
| Autoignition =
| CASNo2_Ref = {{cascite|correct|CAS}}
}}
| CASNo2_Comment = (<small>L</small>)
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9N4LZL67SA
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1 = YSC9WAF8X1
| UNII1_Comment = (<small>D</small>)
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = DL1M07LQ7A
| UNII2_Comment = (<small>L</small>)
| PubChem = 22253
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17399
| SMILES = C([C@@H]([C@H](C(=O)CO)O)O)O
}}
| Section2 = {{Chembox Properties
| C=5 | H=10 | O=5
| Appearance = colorless syrup
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
}}


'''Xylulose''' is a [[ketopentose]], a [[monosaccharide]] containing five [[carbon]] [[atom]]s, and including a [[ketone]] [[functional group]]. It has the [[chemical formula]] {{carbon}}<sub>5</sub>{{hydrogen}}<sub>10</sub>{{oxygen}}<sub>5</sub>. In nature, it occurs in both the <small>L</small>- and <small>D</small>-[[enantiomer]]s.
'''Xylulose''' is a [[ketopentose]], a [[monosaccharide]] containing five [[carbon]] [[atom]]s, and including a [[ketone]] [[functional group]]. It has the [[chemical formula]] {{chem2|auto=1|C5H10O5}}. In nature, it occurs in both the <small>L</small>- and <small>D</small>-[[enantiomer]]s.<ref>{{cite journal |doi=10.1016/S0922-338X(98)80026-3|title=Microbial conversion of d-xylose to xylitol|year=1998|last1=Winkelhausen|first1=Eleonora|last2=Kuzmanova|first2=Slobodanka|journal=Journal of Fermentation and Bioengineering|volume=86|pages=1–14}}</ref> 1-Deoxyxylulose is a precursor to [[terpene]]s via the [[DOXP pathway]].<ref>{{cite journal |doi=10.1042/BST0330785|title=Isoprenoid biosynthetic pathways as anti-infective drug targets|year=2005|last1=Rohdich|first1=F.|last2=Bacher|first2=A.|last3=Eisenreich|first3=W.|journal=Biochemical Society Transactions|volume=33|issue=4|pages=785–791|pmid=16042599}}</ref>
== Pathology ==
<small>L</small>-Xylulose accumulates in the [[urine]] in patients with [[pentosuria]], due to a deficiency in [[L-xylulose reductase]]. Since <small>L</small>-xylulose is a reducing sugar like [[D-glucose|<small>D</small>-glucose]], pentosuria patients have been wrongly diagnosed in the past to be [[diabetic]].


== References ==
In animals, <small>L</small>-Xylulose accumulates in the [[urine]] in patients with [[pentosuria]]. Since <small>L</small>-xylulose is a reducing sugar like [[D-glucose|<small>D</small>-glucose]], pentosuria patients have been wrongly diagnosed in the past to be [[diabetic]].

== See also ==
* [[Arabinose]]
* [[Deoxyribose]]
* [[Lyxose]]
* [[Ribose]]
* [[Ribulose]]
* [[Xylose]]
* [[L-xylulose reductase]]

==References==
{{Reflist}}
{{Reflist}}

==External links==
{{ChemicalSources}}

[[Category:Ketoses]]
[[Category:Monosaccharides]]


{{organic-compound-stub}}


{{Carbohydrates}}
{{Carbohydrates}}


[[Category:Ketopentoses]]
[[de:Xylulose]]
[[es:Xilulosa]]
[[Category:Furanoses]]
[[ja:キシルロース]]
[[fi:Ksyluloosi]]

Latest revision as of 02:05, 18 May 2024

Xylulose[1][2]
Names
IUPAC name
L-threo-Pent-2-ulose
Systematic IUPAC name
(3R,4S)-1,3,4,5-Tetrahydroxypentan-2-one
Other names
threo-Pentulose
threo-2-PentuloseL-Xylulose
Identifiers
3D model (JSmol)
ChEBI
ChemSpider
UNII
  • InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m0/s1 checkY
    Key: ZAQJHHRNXZUBTE-WVZVXSGGSA-N checkY
  • InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m0/s1
  • Key: ZAQJHHRNXZUBTE-WVZVXSGGSA-N
  • C([C@@H]([C@H](C(=O)CO)O)O)O
Properties
C5H10O5
Molar mass 150.130 g·mol−1
Appearance colorless syrup
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☒N verify (what is checkY☒N ?)

Xylulose is a ketopentose, a monosaccharide containing five carbon atoms, and including a ketone functional group. It has the chemical formula C5H10O5. In nature, it occurs in both the L- and D-enantiomers.[3] 1-Deoxyxylulose is a precursor to terpenes via the DOXP pathway.[4]

Pathology[edit]

L-Xylulose accumulates in the urine in patients with pentosuria, due to a deficiency in L-xylulose reductase. Since L-xylulose is a reducing sugar like D-glucose, pentosuria patients have been wrongly diagnosed in the past to be diabetic.

References[edit]

  1. ^ Data is for L-xylulose.
  2. ^ Merck Index, 11th Edition, 9996.
  3. ^ Winkelhausen, Eleonora; Kuzmanova, Slobodanka (1998). "Microbial conversion of d-xylose to xylitol". Journal of Fermentation and Bioengineering. 86: 1–14. doi:10.1016/S0922-338X(98)80026-3.
  4. ^ Rohdich, F.; Bacher, A.; Eisenreich, W. (2005). "Isoprenoid biosynthetic pathways as anti-infective drug targets". Biochemical Society Transactions. 33 (4): 785–791. doi:10.1042/BST0330785. PMID 16042599.