Lafutidin – razlika između verzija
m . |
m uklanjam nepotreban šablon |
||
| (Nije prikazano 5 međuverzija 3 korisnika) | |||
| Red 1: | Red 1: | ||
{{Drugbox-lat |
{{Drugbox-lat |
||
| verifiedrevid = 443919033 |
| verifiedrevid = 443919033 |
||
| IUPAC_name = 2-[(2-furilmetil)sulfinil]- |
| IUPAC_name = 2-[(2-furilmetil)sulfinil]-''N''-((2''Z'')-4[4-(piperidin-1-ilmetil)piridin-2-il]oksi}}but-2-en-1-il)acetamid |
||
| image = Lafutidine.png |
| image = Lafutidine.png |
||
| width = 250 |
| width = 250 |
||
| Red 25: | Red 25: | ||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| Red 47: | Red 47: | ||
| chemical_formula = |
| chemical_formula = |
||
| C=22 | H=29 | N=3 | O=4 | S=1 |
| C=22 | H=29 | N=3 | O=4 | S=1 |
||
| molecular_weight = 431,54 |
| molecular_weight = 431,54 g/mol |
||
| smiles = C1CCN(CC1)CC2=CC(=NC=C2)OCC=CCNC(=O)CS(=O)CC3=CC=CO3 |
|||
| smiles = |
|||
| InChI = |
| InChI = |
||
| InChIKey = |
| InChIKey = |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C22H29N3O4S/c26-21(18-30(27)17-20-7-6-14-28-20)23-9-2-5-13-29-22-15-19(8-10-24-22)16-25-11-3-1-4-12-25/h2,5-8,10,14-15H,1,3-4,9,11-13,16-18H2,(H,23,26)/b5-2- |
|||
| StdInChI = |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = |
| StdInChIKey = KMZQAVXSMUKBPD-DJWKRKHSSA-N |
||
}} |
}} |
||
| Red 61: | Red 61: | ||
== Reference == |
== Reference == |
||
{{reflist|2}} |
{{reflist|2}} |
||
== Literatura == |
|||
== Spoljašnje veze == |
== Spoljašnje veze == |
||
| Red 68: | Red 66: | ||
{{Histaminergics}} |
{{Histaminergics}} |
||
{{Medicinsko upozorenje-lat}} |
|||
[[Kategorija:Antagonisti H2 receptora]] |
[[Kategorija:Antagonisti H2 receptora]] |
||
Aktualna verzija na datum 7 septembar 2023 u 10:06
| (IUPAC) ime | |
|---|---|
| 2-[(2-furilmetil)sulfinil]-N-((2Z)-4[4-(piperidin-1-ilmetil)piridin-2-il]oksi | |
| Klinički podaci | |
| Identifikatori | |
| ATC kod | ? |
| Hemijski podaci | |
| Formula | ? |
| Farmakoinformacioni podaci | |
| Trudnoća | ? |
| Pravni status | |
but-2-en-1-il)acetamid
| image = Lafutidine.png | width = 250 | image2 = | width2 =
| tradename = | Drugs.com = Internacionalno ime leka | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Oralno
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = 
| chemical_formula =
| C=22 | H=29 | N=3 | O=4 | S=1
| molecular_weight = 431,54 g/mol
| smiles = C1CCN(CC1)CC2=CC(=NC=C2)OCC=CCNC(=O)CS(=O)CC3=CC=CO3
| InChI =
| InChIKey =
| StdInChI_Ref =
Lafutidin (INN) je antagonist H2 receptora.[1][2]
- ↑ Hardman JG, Limbird LE, Gilman AG. (2001). Goodman & Gilman's The Pharmacological Basis of Therapeutics (10 izd.). New York: McGraw-Hill. DOI:10.1036/0071422803. ISBN 0-07-135469-7.
- ↑ Pdr Staff (2009). PDR: Physicians Desk Reference 2010 (Physicians' Desk Reference (Pdr)). Rozelle, N.S.W: Thomson Reuters. ISBN 1-56363-748-0.
